About (2,6-dioxocyclohexylidene)methanethiolate;gold(1+)
(2,6-dioxocyclohexylidene)methanethiolate;gold(1+) (PubChem CID 59101986) has the molecular formula C7H7AuO2S
and a molecular weight of 352.17 g/mol. Its IUPAC name is (2,6-dioxocyclohexylidene)methanethiolate;gold(1+).
Molecular Properties
| Compound Name | (2,6-dioxocyclohexylidene)methanethiolate;gold(1+) |
| PubChem CID | 59101986 |
| Molecular Formula | C7H7AuO2S |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | (2,6-dioxocyclohexylidene)methanethiolate;gold(1+) |
| SMILES | O=C1CCCC(=O)C1=C[S-].[Au+] |
| InChI | InChI=1S/C7H8O2S.Au/c8-6-2-1-3-7(9)5(6)4-10;/h4,10H,1-3H2;/q;+1/p-1 |
| InChIKey | WKJAXOWNFIHVPQ-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dioxocyclohexylidene)methanethiolate;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dioxocyclohexylidene)methanethiolate;gold(1+)?
The IUPAC name of (2,6-dioxocyclohexylidene)methanethiolate;gold(1+) (CID 59101986) is (2,6-dioxocyclohexylidene)methanethiolate;gold(1+).
What is the SMILES notation for (2,6-dioxocyclohexylidene)methanethiolate;gold(1+)?
The canonical SMILES for (2,6-dioxocyclohexylidene)methanethiolate;gold(1+) is O=C1CCCC(=O)C1=C[S-].[Au+].
What is the InChIKey of (2,6-dioxocyclohexylidene)methanethiolate;gold(1+)?
The InChIKey is WKJAXOWNFIHVPQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O2S.Au/c8-6-2-1-3-7(9)5(6)4-10;/h4,10H,1-3H2;/q;+1/p-1.
What are the key properties of (2,6-dioxocyclohexylidene)methanethiolate;gold(1+)?
(2,6-dioxocyclohexylidene)methanethiolate;gold(1+) has a molecular weight of 352.17 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dioxocyclohexylidene)methanethiolate;gold(1+) is sourced from PubChem (CID 59101986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).