About 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+)
6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) (PubChem CID 59102023) has the molecular formula C10H19AuOS
and a molecular weight of 384.30 g/mol. Its IUPAC name is 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+).
Molecular Properties
| Compound Name | 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) |
| PubChem CID | 59102023 |
| Molecular Formula | C10H19AuOS |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) |
| SMILES | CCC1OC([S-])C(C)C(C)C1C.[Au+] |
| InChI | InChI=1S/C10H20OS.Au/c1-5-9-7(3)6(2)8(4)10(12)11-9;/h6-10,12H,5H2,1-4H3;/q;+1/p-1 |
| InChIKey | UTDKVBWAVBJNBW-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+)?
The IUPAC name of 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) (CID 59102023) is 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+).
What is the SMILES notation for 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+)?
The canonical SMILES for 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) is CCC1OC([S-])C(C)C(C)C1C.[Au+].
What is the InChIKey of 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+)?
The InChIKey is UTDKVBWAVBJNBW-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20OS.Au/c1-5-9-7(3)6(2)8(4)10(12)11-9;/h6-10,12H,5H2,1-4H3;/q;+1/p-1.
What are the key properties of 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+)?
6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) has a molecular weight of 384.30 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,4,5-trimethyloxane-2-thiolate;gold(1+) is sourced from PubChem (CID 59102023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).