About (E)-N,N'-diethylhex-3-enediamide
(E)-N,N'-diethylhex-3-enediamide (PubChem CID 59102602) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is (E)-N,N'-diethylhex-3-enediamide.
Molecular Properties
| Compound Name | (E)-N,N'-diethylhex-3-enediamide |
| PubChem CID | 59102602 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (E)-N,N'-diethylhex-3-enediamide |
| SMILES | CCNC(=O)C/C=C/CC(=O)NCC |
| InChI | InChI=1S/C10H18N2O2/c1-3-11-9(13)7-5-6-8-10(14)12-4-2/h5-6H,3-4,7-8H2,1-2H3,(H,11,13)(H,12,14)/b6-5+ |
| InChIKey | AWLBJQJGYNWNKF-AATRIKPKSA-N |
| XLogP | 0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N'-diethylhex-3-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-diethylhex-3-enediamide?
The IUPAC name of (E)-N,N'-diethylhex-3-enediamide (CID 59102602) is (E)-N,N'-diethylhex-3-enediamide.
What is the SMILES notation for (E)-N,N'-diethylhex-3-enediamide?
The canonical SMILES for (E)-N,N'-diethylhex-3-enediamide is CCNC(=O)C/C=C/CC(=O)NCC.
What is the InChIKey of (E)-N,N'-diethylhex-3-enediamide?
The InChIKey is AWLBJQJGYNWNKF-AATRIKPKSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-3-11-9(13)7-5-6-8-10(14)12-4-2/h5-6H,3-4,7-8H2,1-2H3,(H,11,13)(H,12,14)/b6-5+.
What are the key properties of (E)-N,N'-diethylhex-3-enediamide?
(E)-N,N'-diethylhex-3-enediamide has a molecular weight of 198.27 g/mol, XLogP of 0.60, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-diethylhex-3-enediamide is sourced from PubChem (CID 59102602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).