C22H36AcO7 — CID 59102771
actinium;(2S)-4-ethyl-1,4,5,7,10,13-hexahydroxy-2,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadec-11-en-9-one (PubChem CID 59102771) has the molecular formula C22H36AcO7 and a molecular weight of 639.52 g/mol. Its IUPAC name is actinium;(2S)-4-ethyl-1,4,5,7,10,13-hexahydroxy-2,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadec-11-en-9-one.
| Compound Name | actinium;(2S)-4-ethyl-1,4,5,7,10,13-hexahydroxy-2,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadec-11-en-9-one |
|---|---|
| PubChem CID | 59102771 |
| Molecular Formula | C22H36AcO7 |
| Molecular Weight | 639.52 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | actinium;(2S)-4-ethyl-1,4,5,7,10,13-hexahydroxy-2,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadec-11-en-9-one |
| SMILES | CCC1(O)C(O)CC(O)C2(C)C(=O)C(O)C3=C(C)C(O)CC(O)(C(C)C12)C3(C)C.[Ac] |
| InChI | InChI=1S/C22H36O7.Ac/c1-7-21(28)14(25)8-13(24)20(6)17(21)11(3)22(29)9-12(23)10(2)15(19(22,4)5)16(26)18(20)27;/h11-14,16-17,23-26,28-29H,7-9H2,1-6H3; |
| InChIKey | CTRXFVOWKNYNHG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.52 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|