C11H18S — CID 59102794
2,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophene (PubChem CID 59102794) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is 2,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophene.
| Compound Name | 2,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophene |
|---|---|
| PubChem CID | 59102794 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophene |
| SMILES | CC1=C(C)C2CCC(C)CC2S1 |
| InChI | InChI=1S/C11H18S/c1-7-4-5-10-8(2)9(3)12-11(10)6-7/h7,10-11H,4-6H2,1-3H3 |
| InChIKey | DZFAYEVJGMQVFE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |