C15H10F5NO4S — CID 59102843
[4-(ethylcarbamoyl)-2,3,5,6-tetrafluorophenyl] 4-fluorobenzenesulfonate (PubChem CID 59102843) has the molecular formula C15H10F5NO4S and a molecular weight of 395.31 g/mol. Its IUPAC name is [4-(ethylcarbamoyl)-2,3,5,6-tetrafluorophenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-(ethylcarbamoyl)-2,3,5,6-tetrafluorophenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 59102843 |
| Molecular Formula | C15H10F5NO4S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | [4-(ethylcarbamoyl)-2,3,5,6-tetrafluorophenyl] 4-fluorobenzenesulfonate |
| SMILES | CCNC(=O)c1c(F)c(F)c(OS(=O)(=O)c2ccc(F)cc2)c(F)c1F |
| InChI | InChI=1S/C15H10F5NO4S/c1-2-21-15(22)9-10(17)12(19)14(13(20)11(9)18)25-26(23,24)8-5-3-7(16)4-6-8/h3-6H,2H2,1H3,(H,21,22) |
| InChIKey | AMPXTKNPDCADFQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|