C16H25ClN2 — CID 59103722
N'-[(3E)-4-chloropenta-1,3-dien-2-yl]-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-N,N-dimethylpropane-1,3-diamine (PubChem CID 59103722) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is N'-[(3E)-4-chloropenta-1,3-dien-2-yl]-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-[(3E)-4-chloropenta-1,3-dien-2-yl]-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 59103722 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N'-[(3E)-4-chloropenta-1,3-dien-2-yl]-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-N,N-dimethylpropane-1,3-diamine |
| SMILES | C=C/C=C\C(=C)N(CCCN(C)C)C(=C)/C=C(\C)Cl |
| InChI | InChI=1S/C16H25ClN2/c1-7-8-10-15(3)19(12-9-11-18(5)6)16(4)13-14(2)17/h7-8,10,13H,1,3-4,9,11-12H2,2,5-6H3/b10-8-,14-13+ |
| InChIKey | IWDLKZYQCTVSRO-PHQHADLFSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|