About 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine
3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine (PubChem CID 59104122) has the molecular formula C4H9N2O2-
and a molecular weight of 117.13 g/mol. Its IUPAC name is 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine.
Molecular Properties
| Compound Name | 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine |
| PubChem CID | 59104122 |
| Molecular Formula | C4H9N2O2- |
| Molecular Weight | 117.13 g/mol |
| Exact Mass | 117.07 |
| IUPAC Name | 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine |
| SMILES | CC1NON([O-])C1C |
| InChI | InChI=1S/C4H9N2O2/c1-3-4(2)6(7)8-5-3/h3-5H,1-2H3/q-1 |
| InChIKey | XQOQDRWNMPAPDY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.13 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine?
The IUPAC name of 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine (CID 59104122) is 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine.
What is the SMILES notation for 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine?
The canonical SMILES for 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine is CC1NON([O-])C1C.
What is the InChIKey of 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine?
The InChIKey is XQOQDRWNMPAPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N2O2/c1-3-4(2)6(7)8-5-3/h3-5H,1-2H3/q-1.
What are the key properties of 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine?
3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine has a molecular weight of 117.13 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2-oxido-1,2,5-oxadiazolidine is sourced from PubChem (CID 59104122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).