C6H9IO — CID 59104586
(1R,2R,5R,6S)-6-iodo-2-methyl-3-oxabicyclo[3.1.0]hexane (PubChem CID 59104586) has the molecular formula C6H9IO and a molecular weight of 224.04 g/mol. Its IUPAC name is (1R,2R,5R,6S)-6-iodo-2-methyl-3-oxabicyclo[3.1.0]hexane.
| Compound Name | (1R,2R,5R,6S)-6-iodo-2-methyl-3-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 59104586 |
| Molecular Formula | C6H9IO |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | (1R,2R,5R,6S)-6-iodo-2-methyl-3-oxabicyclo[3.1.0]hexane |
| SMILES | C[C@H]1OC[C@@H]2[C@H](I)[C@H]21 |
| InChI | InChI=1S/C6H9IO/c1-3-5-4(2-8-3)6(5)7/h3-6H,2H2,1H3/t3-,4+,5+,6+/m1/s1 |
| InChIKey | LFJOZUFBXLWWSD-VANKVMQKSA-N |
| XLogP | 1.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|