About (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one
(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one (PubChem CID 59104852) has the molecular formula C23H17NOS
and a molecular weight of 355.46 g/mol. Its IUPAC name is (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one.
Molecular Properties
| Compound Name | (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one |
| PubChem CID | 59104852 |
| Molecular Formula | C23H17NOS |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one |
| SMILES | CN1/C(=C2/C(=O)c3ccccc3C2c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C23H17NOS/c1-24-18-13-7-8-14-19(18)26-23(24)21-20(15-9-3-2-4-10-15)16-11-5-6-12-17(16)22(21)25/h2-14,20H,1H3/b23-21- |
| InChIKey | DSPSVHIUFLTJAM-LNVKXUELSA-N |
| XLogP | 5.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one?
The IUPAC name of (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one (CID 59104852) is (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one.
What is the SMILES notation for (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one?
The canonical SMILES for (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one is CN1/C(=C2/C(=O)c3ccccc3C2c2ccccc2)Sc2ccccc21.
What is the InChIKey of (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one?
The InChIKey is DSPSVHIUFLTJAM-LNVKXUELSA-N. The full InChI is InChI=1S/C23H17NOS/c1-24-18-13-7-8-14-19(18)26-23(24)21-20(15-9-3-2-4-10-15)16-11-5-6-12-17(16)22(21)25/h2-14,20H,1H3/b23-21-.
What are the key properties of (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one?
(2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one has a molecular weight of 355.46 g/mol, XLogP of 5.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-3H-inden-1-one is sourced from PubChem (CID 59104852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).