C23H30BrN — CID 59105356
4-[(2-bromo-5-methylphenyl)methyl]-1-[1-(2-methylphenyl)propan-2-yl]piperidine (PubChem CID 59105356) has the molecular formula C23H30BrN and a molecular weight of 400.40 g/mol. Its IUPAC name is 4-[(2-bromo-5-methylphenyl)methyl]-1-[1-(2-methylphenyl)propan-2-yl]piperidine.
| Compound Name | 4-[(2-bromo-5-methylphenyl)methyl]-1-[1-(2-methylphenyl)propan-2-yl]piperidine |
|---|---|
| PubChem CID | 59105356 |
| Molecular Formula | C23H30BrN |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-[(2-bromo-5-methylphenyl)methyl]-1-[1-(2-methylphenyl)propan-2-yl]piperidine |
| SMILES | Cc1ccc(Br)c(CC2CCN(C(C)Cc3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C23H30BrN/c1-17-8-9-23(24)22(14-17)16-20-10-12-25(13-11-20)19(3)15-21-7-5-4-6-18(21)2/h4-9,14,19-20H,10-13,15-16H2,1-3H3 |
| InChIKey | FLOJFCIAEWWJPU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |