C14H32N2O5P+ — CID 59105482
3-[hydroperoxy(hydroxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoylamino)ethyl]azanium (PubChem CID 59105482) has the molecular formula C14H32N2O5P+ and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-[hydroperoxy(hydroxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoylamino)ethyl]azanium.
| Compound Name | 3-[hydroperoxy(hydroxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 59105482 |
| Molecular Formula | C14H32N2O5P+ |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 3-[hydroperoxy(hydroxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoylamino)ethyl]azanium |
| SMILES | CC(C)C(C)(C)C(=O)NCC[N+](C)(C)CCCP(=O)(O)OO |
| InChI | InChI=1S/C14H31N2O5P/c1-12(2)14(3,4)13(17)15-8-10-16(5,6)9-7-11-22(19,20)21-18/h12H,7-11H2,1-6H3,(H2-,15,17,18,19,20)/p+1 |
| InChIKey | MJNXQTCXUXGOPC-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|