About N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline
N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline (PubChem CID 591062) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline |
| PubChem CID | 591062 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline |
| SMILES | CN(C)c1ccc(C2OCC(C)([N+](=O)[O-])CO2)cc1 |
| InChI | InChI=1S/C13H18N2O4/c1-13(15(16)17)8-18-12(19-9-13)10-4-6-11(7-5-10)14(2)3/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | VKBRTYKGJAYUEE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline?
The IUPAC name of N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline (CID 591062) is N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline.
What is the SMILES notation for N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline?
The canonical SMILES for N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline is CN(C)c1ccc(C2OCC(C)([N+](=O)[O-])CO2)cc1.
What is the InChIKey of N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline?
The InChIKey is VKBRTYKGJAYUEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-13(15(16)17)8-18-12(19-9-13)10-4-6-11(7-5-10)14(2)3/h4-7,12H,8-9H2,1-3H3.
What are the key properties of N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline?
N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline has a molecular weight of 266.30 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-(5-methyl-5-nitro-1,3-dioxan-2-yl)aniline is sourced from PubChem (CID 591062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).