About 3-methanidyl-1,3-oxazolidin-3-ium-5-one
3-methanidyl-1,3-oxazolidin-3-ium-5-one (PubChem CID 59106404) has the molecular formula C4H7NO2
and a molecular weight of 101.11 g/mol. Its IUPAC name is 3-methanidyl-1,3-oxazolidin-3-ium-5-one.
Molecular Properties
| Compound Name | 3-methanidyl-1,3-oxazolidin-3-ium-5-one |
| PubChem CID | 59106404 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | 3-methanidyl-1,3-oxazolidin-3-ium-5-one |
| SMILES | [CH2-][NH+]1COC(=O)C1 |
| InChI | InChI=1S/C4H7NO2/c1-5-2-4(6)7-3-5/h5H,1-3H2 |
| InChIKey | VCWBAPGIWDBEGI-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methanidyl-1,3-oxazolidin-3-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methanidyl-1,3-oxazolidin-3-ium-5-one?
The IUPAC name of 3-methanidyl-1,3-oxazolidin-3-ium-5-one (CID 59106404) is 3-methanidyl-1,3-oxazolidin-3-ium-5-one.
What is the SMILES notation for 3-methanidyl-1,3-oxazolidin-3-ium-5-one?
The canonical SMILES for 3-methanidyl-1,3-oxazolidin-3-ium-5-one is [CH2-][NH+]1COC(=O)C1.
What is the InChIKey of 3-methanidyl-1,3-oxazolidin-3-ium-5-one?
The InChIKey is VCWBAPGIWDBEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c1-5-2-4(6)7-3-5/h5H,1-3H2.
What are the key properties of 3-methanidyl-1,3-oxazolidin-3-ium-5-one?
3-methanidyl-1,3-oxazolidin-3-ium-5-one has a molecular weight of 101.11 g/mol, XLogP of -1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanidyl-1,3-oxazolidin-3-ium-5-one is sourced from PubChem (CID 59106404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).