C20H15Cl2F3N6 — CID 59106730
N'-[2-(2,4-dichlorophenyl)-5-(trifluoromethyl)pyrimidin-4-yl]-N-(1H-indazol-3-yl)ethane-1,2-diamine (PubChem CID 59106730) has the molecular formula C20H15Cl2F3N6 and a molecular weight of 467.28 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenyl)-5-(trifluoromethyl)pyrimidin-4-yl]-N-(1H-indazol-3-yl)ethane-1,2-diamine.
| Compound Name | N'-[2-(2,4-dichlorophenyl)-5-(trifluoromethyl)pyrimidin-4-yl]-N-(1H-indazol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 59106730 |
| Molecular Formula | C20H15Cl2F3N6 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | N'-[2-(2,4-dichlorophenyl)-5-(trifluoromethyl)pyrimidin-4-yl]-N-(1H-indazol-3-yl)ethane-1,2-diamine |
| SMILES | FC(F)(F)c1cnc(-c2ccc(Cl)cc2Cl)nc1NCCNc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C20H15Cl2F3N6/c21-11-5-6-12(15(22)9-11)17-28-10-14(20(23,24)25)19(29-17)27-8-7-26-18-13-3-1-2-4-16(13)30-31-18/h1-6,9-10H,7-8H2,(H2,26,30,31)(H,27,28,29) |
| InChIKey | GPSVSNIWPCRKCV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|