C20H15Cl2F3N6 — CID 59106793
6-[3-[[2-(2,4-dichlorophenyl)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile (PubChem CID 59106793) has the molecular formula C20H15Cl2F3N6 and a molecular weight of 467.28 g/mol. Its IUPAC name is 6-[3-[[2-(2,4-dichlorophenyl)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[3-[[2-(2,4-dichlorophenyl)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59106793 |
| Molecular Formula | C20H15Cl2F3N6 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 6-[3-[[2-(2,4-dichlorophenyl)-6-(trifluoromethyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCCNc2cc(C(F)(F)F)nc(-c3ccc(Cl)cc3Cl)n2)nc1 |
| InChI | InChI=1S/C20H15Cl2F3N6/c21-13-3-4-14(15(22)8-13)19-30-16(20(23,24)25)9-18(31-19)28-7-1-6-27-17-5-2-12(10-26)11-29-17/h2-5,8-9,11H,1,6-7H2,(H,27,29)(H,28,30,31) |
| InChIKey | UEVCYRGWWZYHEC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|