C25H19Cl2FN6 — CID 59106809
6-[3-[[2-(2,4-dichlorophenyl)-6-(2-fluorophenyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile (PubChem CID 59106809) has the molecular formula C25H19Cl2FN6 and a molecular weight of 493.37 g/mol. Its IUPAC name is 6-[3-[[2-(2,4-dichlorophenyl)-6-(2-fluorophenyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[3-[[2-(2,4-dichlorophenyl)-6-(2-fluorophenyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59106809 |
| Molecular Formula | C25H19Cl2FN6 |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 6-[3-[[2-(2,4-dichlorophenyl)-6-(2-fluorophenyl)pyrimidin-4-yl]amino]propylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCCNc2cc(-c3ccccc3F)nc(-c3ccc(Cl)cc3Cl)n2)nc1 |
| InChI | InChI=1S/C25H19Cl2FN6/c26-17-7-8-18(20(27)12-17)25-33-22(19-4-1-2-5-21(19)28)13-24(34-25)31-11-3-10-30-23-9-6-16(14-29)15-32-23/h1-2,4-9,12-13,15H,3,10-11H2,(H,30,32)(H,31,33,34) |
| InChIKey | QETNZGWDFWLXFL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|