C9H13N3O5 — CID 59107032
2-amino-2-methyl-3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)propanoic acid (PubChem CID 59107032) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-amino-2-methyl-3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)propanoic acid.
| Compound Name | 2-amino-2-methyl-3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)propanoic acid |
|---|---|
| PubChem CID | 59107032 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-amino-2-methyl-3-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)propanoic acid |
| SMILES | CN1C(=O)NC(=O)C(CC(C)(N)C(=O)O)C1=O |
| InChI | InChI=1S/C9H13N3O5/c1-9(10,7(15)16)3-4-5(13)11-8(17)12(2)6(4)14/h4H,3,10H2,1-2H3,(H,15,16)(H,11,13,17) |
| InChIKey | QGDADCGVIWHMQO-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|