C7H8N2O4 — CID 59107035
5-(2-oxopropyl)-1,3-diazinane-2,4,6-trione (PubChem CID 59107035) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 5-(2-oxopropyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-oxopropyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59107035 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-(2-oxopropyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)CC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C7H8N2O4/c1-3(10)2-4-5(11)8-7(13)9-6(4)12/h4H,2H2,1H3,(H2,8,9,11,12,13) |
| InChIKey | QSCYBUDDULCEKS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|