About 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid
3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid (PubChem CID 59107126) has the molecular formula C30H22N2O4
and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid |
| PubChem CID | 59107126 |
| Molecular Formula | C30H22N2O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)COc1cccc(-c2ccccc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C30H22N2O4/c33-26(30(34)35)19-36-23-15-9-14-22(18-23)24-16-7-8-17-25(24)29-31-27(20-10-3-1-4-11-20)28(32-29)21-12-5-2-6-13-21/h1-18H,19H2,(H,31,32)(H,34,35) |
| InChIKey | ACMLUYVFKREVSB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid?
The IUPAC name of 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid (CID 59107126) is 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid.
What is the SMILES notation for 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid?
The canonical SMILES for 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid is O=C(O)C(=O)COc1cccc(-c2ccccc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1.
What is the InChIKey of 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid?
The InChIKey is ACMLUYVFKREVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N2O4/c33-26(30(34)35)19-36-23-15-9-14-22(18-23)24-16-7-8-17-25(24)29-31-27(20-10-3-1-4-11-20)28(32-29)21-12-5-2-6-13-21/h1-18H,19H2,(H,31,32)(H,34,35).
What are the key properties of 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid?
3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid has a molecular weight of 474.52 g/mol, XLogP of 6.11, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenoxy]-2-oxopropanoic acid is sourced from PubChem (CID 59107126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).