C8H15N3O — CID 59107300
(1R,2R,4R,5S)-2-azido-4,5-dimethylcyclohexan-1-ol (PubChem CID 59107300) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is (1R,2R,4R,5S)-2-azido-4,5-dimethylcyclohexan-1-ol.
| Compound Name | (1R,2R,4R,5S)-2-azido-4,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 59107300 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (1R,2R,4R,5S)-2-azido-4,5-dimethylcyclohexan-1-ol |
| SMILES | C[C@@H]1C[C@@H](N=[N+]=[N-])[C@H](O)C[C@@H]1C |
| InChI | InChI=1S/C8H15N3O/c1-5-3-7(10-11-9)8(12)4-6(5)2/h5-8,12H,3-4H2,1-2H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | TTZGATNXXPILGR-ULAWRXDQSA-N |
| XLogP | 2.09 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|