C34H35ClN4O7S2 — CID 59107561
4-[5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate (PubChem CID 59107561) has the molecular formula C34H35ClN4O7S2 and a molecular weight of 711.26 g/mol. Its IUPAC name is 4-[5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59107561 |
| Molecular Formula | C34H35ClN4O7S2 |
| Molecular Weight | 711.26 g/mol |
| Exact Mass | 710.16 |
| IUPAC Name | 4-[5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]butane-1-sulfonate |
| SMILES | CCN1C(=CC=Cc2oc3ccc(-c4ccccc4)cc3[n+]2CCCCS(=O)(=O)O)N(CCCCS(=O)(=O)[O-])c2cc(C#N)c(Cl)cc21 |
| InChI | InChI=1S/C34H35ClN4O7S2/c1-2-37-30-23-28(35)27(24-36)22-29(30)38(17-6-8-19-47(40,41)42)33(37)13-10-14-34-39(18-7-9-20-48(43,44)45)31-21-26(15-16-32(31)46-34)25-11-4-3-5-12-25/h3-5,10-16,21-23H,2,6-9,17-20H2,1H3,(H-,40,41,42,43,44,45) |
| InChIKey | LYJSSXJNABUCRX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 158.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.26 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|