About (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one
(4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one (PubChem CID 59107737) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one.
Molecular Properties
| Compound Name | (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one |
| PubChem CID | 59107737 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one |
| SMILES | CN[C@@H]1C(=O)CN(C)[C@H]1C |
| InChI | InChI=1S/C7H14N2O/c1-5-7(8-2)6(10)4-9(5)3/h5,7-8H,4H2,1-3H3/t5-,7-/m0/s1 |
| InChIKey | BXIFWFQARRWPCS-FSPLSTOPSA-N |
| XLogP | -0.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one?
The IUPAC name of (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one (CID 59107737) is (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one.
What is the SMILES notation for (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one?
The canonical SMILES for (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one is CN[C@@H]1C(=O)CN(C)[C@H]1C.
What is the InChIKey of (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one?
The InChIKey is BXIFWFQARRWPCS-FSPLSTOPSA-N. The full InChI is InChI=1S/C7H14N2O/c1-5-7(8-2)6(10)4-9(5)3/h5,7-8H,4H2,1-3H3/t5-,7-/m0/s1.
What are the key properties of (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one?
(4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one has a molecular weight of 142.20 g/mol, XLogP of -0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-1,5-dimethyl-4-(methylamino)pyrrolidin-3-one is sourced from PubChem (CID 59107737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).