C23H47N7O4 — CID 59107940
N'-[2-[bis[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]amino]ethyl]-N-propylbutanediamide (PubChem CID 59107940) has the molecular formula C23H47N7O4 and a molecular weight of 485.67 g/mol. Its IUPAC name is N'-[2-[bis[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]amino]ethyl]-N-propylbutanediamide.
| Compound Name | N'-[2-[bis[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]amino]ethyl]-N-propylbutanediamide |
|---|---|
| PubChem CID | 59107940 |
| Molecular Formula | C23H47N7O4 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | N'-[2-[bis[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]amino]ethyl]-N-propylbutanediamide |
| SMILES | CCCNC(=O)CCC(=O)NCCN(CCNC(C)(C)/C(C)=N\O)CCNC(C)(C)/C(C)=N\O |
| InChI | InChI=1S/C23H47N7O4/c1-8-11-24-20(31)9-10-21(32)25-12-15-30(16-13-26-22(4,5)18(2)28-33)17-14-27-23(6,7)19(3)29-34/h26-27,33-34H,8-17H2,1-7H3,(H,24,31)(H,25,32)/b28-18-,29-19- |
| InChIKey | PIAPWASNBQZLJO-IFEPHKIBSA-N |
| XLogP | 1.15 |
| TPSA | 150.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|