About 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one
3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one (PubChem CID 59108268) has the molecular formula C27H31ClO3
and a molecular weight of 439.00 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one |
| PubChem CID | 59108268 |
| Molecular Formula | C27H31ClO3 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one |
| SMILES | CCOCOC1=C(c2c(C)cc(-c3ccc(Cl)cc3)cc2C)C(=O)CC12CCCCC2 |
| InChI | InChI=1S/C27H31ClO3/c1-4-30-17-31-26-25(23(29)16-27(26)12-6-5-7-13-27)24-18(2)14-21(15-19(24)3)20-8-10-22(28)11-9-20/h8-11,14-15H,4-7,12-13,16-17H2,1-3H3 |
| InChIKey | JEBHYRCOZQIPHO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one?
The IUPAC name of 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one (CID 59108268) is 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one?
The canonical SMILES for 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one is CCOCOC1=C(c2c(C)cc(-c3ccc(Cl)cc3)cc2C)C(=O)CC12CCCCC2.
What is the InChIKey of 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one?
The InChIKey is JEBHYRCOZQIPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31ClO3/c1-4-30-17-31-26-25(23(29)16-27(26)12-6-5-7-13-27)24-18(2)14-21(15-19(24)3)20-8-10-22(28)11-9-20/h8-11,14-15H,4-7,12-13,16-17H2,1-3H3.
What are the key properties of 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one?
3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one has a molecular weight of 439.00 g/mol, XLogP of 7.27, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-4-(ethoxymethoxy)spiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 59108268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).