C15H34N4 — CID 59108273
N-ethyl-3-(4-ethyl-1,4,8-triazacycloundec-1-yl)propan-1-amine (PubChem CID 59108273) has the molecular formula C15H34N4 and a molecular weight of 270.46 g/mol. Its IUPAC name is N-ethyl-3-(4-ethyl-1,4,8-triazacycloundec-1-yl)propan-1-amine.
| Compound Name | N-ethyl-3-(4-ethyl-1,4,8-triazacycloundec-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 59108273 |
| Molecular Formula | C15H34N4 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.28 |
| IUPAC Name | N-ethyl-3-(4-ethyl-1,4,8-triazacycloundec-1-yl)propan-1-amine |
| SMILES | CCNCCCN1CCCNCCCN(CC)CC1 |
| InChI | InChI=1S/C15H34N4/c1-3-16-8-5-12-19-13-7-10-17-9-6-11-18(4-2)14-15-19/h16-17H,3-15H2,1-2H3 |
| InChIKey | LAVOCDLCKHDZPR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|