C32H34F3N5O5 — CID 59108579
(2S)-1-[[(2S,4S)-4-(furo[2,3-c]pyridin-2-ylmethyl)-5-oxooxolan-2-yl]methyl]-4-[2-(5-phenyl-1,3-oxazol-2-yl)propan-2-yl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide (PubChem CID 59108579) has the molecular formula C32H34F3N5O5 and a molecular weight of 625.65 g/mol. Its IUPAC name is (2S)-1-[[(2S,4S)-4-(furo[2,3-c]pyridin-2-ylmethyl)-5-oxooxolan-2-yl]methyl]-4-[2-(5-phenyl-1,3-oxazol-2-yl)propan-2-yl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide.
| Compound Name | (2S)-1-[[(2S,4S)-4-(furo[2,3-c]pyridin-2-ylmethyl)-5-oxooxolan-2-yl]methyl]-4-[2-(5-phenyl-1,3-oxazol-2-yl)propan-2-yl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 59108579 |
| Molecular Formula | C32H34F3N5O5 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (2S)-1-[[(2S,4S)-4-(furo[2,3-c]pyridin-2-ylmethyl)-5-oxooxolan-2-yl]methyl]-4-[2-(5-phenyl-1,3-oxazol-2-yl)propan-2-yl]-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide |
| SMILES | CC(C)(c1ncc(-c2ccccc2)o1)N1CCN(C[C@@H]2C[C@@H](Cc3cc4ccncc4o3)C(=O)O2)[C@H](C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C32H34F3N5O5/c1-31(2,30-37-16-27(45-30)20-6-4-3-5-7-20)40-11-10-39(25(18-40)28(41)38-19-32(33,34)35)17-24-14-22(29(42)44-24)13-23-12-21-8-9-36-15-26(21)43-23/h3-9,12,15-16,22,24-25H,10-11,13-14,17-19H2,1-2H3,(H,38,41)/t22-,24+,25+/m1/s1 |
| InChIKey | ZMHNJYGJWBLKDV-VJTSUQJLSA-N |
| XLogP | 4.56 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |