C15H22F3N3O5 — CID 59108708
2-methyl-2-[(3S)-4-prop-2-enoxycarbonyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid (PubChem CID 59108708) has the molecular formula C15H22F3N3O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-methyl-2-[(3S)-4-prop-2-enoxycarbonyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[(3S)-4-prop-2-enoxycarbonyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 59108708 |
| Molecular Formula | C15H22F3N3O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-methyl-2-[(3S)-4-prop-2-enoxycarbonyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid |
| SMILES | C=CCOC(=O)N1CCN(C(C)(C)C(=O)O)C[C@H]1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H22F3N3O5/c1-4-7-26-13(25)21-6-5-20(14(2,3)12(23)24)8-10(21)11(22)19-9-15(16,17)18/h4,10H,1,5-9H2,2-3H3,(H,19,22)(H,23,24)/t10-/m0/s1 |
| InChIKey | VHFAQQLVFWEDMT-JTQLQIEISA-N |
| XLogP | 0.84 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|