About but-2-en-2-ylazanide;rhenium
but-2-en-2-ylazanide;rhenium (PubChem CID 59109582) has the molecular formula C4H8NRe-
and a molecular weight of 256.32 g/mol. Its IUPAC name is but-2-en-2-ylazanide;rhenium.
Molecular Properties
| Compound Name | but-2-en-2-ylazanide;rhenium |
| PubChem CID | 59109582 |
| Molecular Formula | C4H8NRe- |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | but-2-en-2-ylazanide;rhenium |
| SMILES | CC=C(C)[NH-].[Re] |
| InChI | InChI=1S/C4H8N.Re/c1-3-4(2)5;/h3,5H,1-2H3;/q-1; |
| InChIKey | NECXEKZXMUSATA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze but-2-en-2-ylazanide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-en-2-ylazanide;rhenium?
The IUPAC name of but-2-en-2-ylazanide;rhenium (CID 59109582) is but-2-en-2-ylazanide;rhenium.
What is the SMILES notation for but-2-en-2-ylazanide;rhenium?
The canonical SMILES for but-2-en-2-ylazanide;rhenium is CC=C(C)[NH-].[Re].
What is the InChIKey of but-2-en-2-ylazanide;rhenium?
The InChIKey is NECXEKZXMUSATA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N.Re/c1-3-4(2)5;/h3,5H,1-2H3;/q-1;.
What are the key properties of but-2-en-2-ylazanide;rhenium?
but-2-en-2-ylazanide;rhenium has a molecular weight of 256.32 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-en-2-ylazanide;rhenium is sourced from PubChem (CID 59109582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).