C28H41N3O4S — CID 59109651
[2-(methanesulfonamido)phenyl]methyl N-(1-hexyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)carbamate (PubChem CID 59109651) has the molecular formula C28H41N3O4S and a molecular weight of 515.72 g/mol. Its IUPAC name is [2-(methanesulfonamido)phenyl]methyl N-(1-hexyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)carbamate.
| Compound Name | [2-(methanesulfonamido)phenyl]methyl N-(1-hexyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)carbamate |
|---|---|
| PubChem CID | 59109651 |
| Molecular Formula | C28H41N3O4S |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | [2-(methanesulfonamido)phenyl]methyl N-(1-hexyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)carbamate |
| SMILES | CCCCCCN1c2cc(C)c(NC(=O)OCc3ccccc3NS(C)(=O)=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H41N3O4S/c1-7-8-9-12-15-31-26-16-20(2)25(17-23(26)21(3)18-28(31,4)5)29-27(32)35-19-22-13-10-11-14-24(22)30-36(6,33)34/h10-11,13-14,16-17,21,30H,7-9,12,15,18-19H2,1-6H3,(H,29,32) |
| InChIKey | ILOXHRANTDOSRA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|