About [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate
[1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate (PubChem CID 59109699) has the molecular formula C30H44O6
and a molecular weight of 500.68 g/mol. Its IUPAC name is [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate.
Molecular Properties
| Compound Name | [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate |
| PubChem CID | 59109699 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate |
| SMILES | C=Cc1ccc(CCC(CC(C)=O)OC(=O)CC(CC2CCCCC2)OC(=O)CC(CC)OC)cc1 |
| InChI | InChI=1S/C30H44O6/c1-5-23-12-14-24(15-13-23)16-17-27(18-22(3)31)35-30(33)21-28(19-25-10-8-7-9-11-25)36-29(32)20-26(6-2)34-4/h5,12-15,25-28H,1,6-11,16-21H2,2-4H3 |
| InChIKey | RAUXQSDCXRAHQJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate?
The IUPAC name of [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate (CID 59109699) is [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate.
What is the SMILES notation for [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate?
The canonical SMILES for [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate is C=Cc1ccc(CCC(CC(C)=O)OC(=O)CC(CC2CCCCC2)OC(=O)CC(CC)OC)cc1.
What is the InChIKey of [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate?
The InChIKey is RAUXQSDCXRAHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H44O6/c1-5-23-12-14-24(15-13-23)16-17-27(18-22(3)31)35-30(33)21-28(19-25-10-8-7-9-11-25)36-29(32)20-26(6-2)34-4/h5,12-15,25-28H,1,6-11,16-21H2,2-4H3.
What are the key properties of [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate?
[1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate has a molecular weight of 500.68 g/mol, XLogP of 6.24, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclohexyl-4-[1-(4-ethenylphenyl)-5-oxohexan-3-yl]oxy-4-oxobutan-2-yl] 3-methoxypentanoate is sourced from PubChem (CID 59109699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).