C21H25BClN3O4S — CID 59110151
[4-[13-chloro-10-(methylsulfonyloxymethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid (PubChem CID 59110151) has the molecular formula C21H25BClN3O4S and a molecular weight of 461.78 g/mol. Its IUPAC name is [4-[13-chloro-10-(methylsulfonyloxymethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid.
| Compound Name | [4-[13-chloro-10-(methylsulfonyloxymethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59110151 |
| Molecular Formula | C21H25BClN3O4S |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [4-[13-chloro-10-(methylsulfonyloxymethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN(C2c3ccc(Cl)cc3C(COS(C)(=O)=O)=Cc3cccnc32)CC1 |
| InChI | InChI=1S/C21H25BClN3O4S/c1-22(27)26-10-8-25(9-11-26)21-18-6-5-17(23)13-19(18)16(14-30-31(2,28)29)12-15-4-3-7-24-20(15)21/h3-7,12-13,21,27H,8-11,14H2,1-2H3 |
| InChIKey | CXLPXOHVSURRCC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|