C21H20ClF3N2O5S2 — CID 59110157
[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl] trifluoromethanesulfonate (PubChem CID 59110157) has the molecular formula C21H20ClF3N2O5S2 and a molecular weight of 536.98 g/mol. Its IUPAC name is [13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl] trifluoromethanesulfonate.
| Compound Name | [13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59110157 |
| Molecular Formula | C21H20ClF3N2O5S2 |
| Molecular Weight | 536.98 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | [13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl] trifluoromethanesulfonate |
| SMILES | COOSN1CCC(C2c3ccc(Cl)cc3C(OS(=O)(=O)C(F)(F)F)=Cc3cccnc32)CC1 |
| InChI | InChI=1S/C21H20ClF3N2O5S2/c1-30-32-33-27-9-6-13(7-10-27)19-16-5-4-15(22)12-17(16)18(31-34(28,29)21(23,24)25)11-14-3-2-8-26-20(14)19/h2-5,8,11-13,19H,6-7,9-10H2,1H3 |
| InChIKey | LSXRIOPKKMKSLL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.98 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|