C24H29ClN2O5S2 — CID 59110177
3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl]propyl methanesulfonate (PubChem CID 59110177) has the molecular formula C24H29ClN2O5S2 and a molecular weight of 525.09 g/mol. Its IUPAC name is 3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl]propyl methanesulfonate.
| Compound Name | 3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 59110177 |
| Molecular Formula | C24H29ClN2O5S2 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl]propyl methanesulfonate |
| SMILES | COOSN1CCC(C2c3ccc(Cl)cc3C(CCCOS(C)(=O)=O)=Cc3cccnc32)CC1 |
| InChI | InChI=1S/C24H29ClN2O5S2/c1-30-32-33-27-12-9-17(10-13-27)23-21-8-7-20(25)16-22(21)18(6-4-14-31-34(2,28)29)15-19-5-3-11-26-24(19)23/h3,5,7-8,11,15-17,23H,4,6,9-10,12-14H2,1-2H3 |
| InChIKey | NXYAUPBEYPYEHU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|