C8H17FN2 — CID 59110301
(3S,4S)-4-(2-fluoroethyl)-N-methylpiperidin-3-amine (PubChem CID 59110301) has the molecular formula C8H17FN2 and a molecular weight of 160.24 g/mol. Its IUPAC name is (3S,4S)-4-(2-fluoroethyl)-N-methylpiperidin-3-amine.
| Compound Name | (3S,4S)-4-(2-fluoroethyl)-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 59110301 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | (3S,4S)-4-(2-fluoroethyl)-N-methylpiperidin-3-amine |
| SMILES | CN[C@@H]1CNCC[C@H]1CCF |
| InChI | InChI=1S/C8H17FN2/c1-10-8-6-11-5-3-7(8)2-4-9/h7-8,10-11H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | ATXLUVSTMRUUNR-HTQZYQBOSA-N |
| XLogP | 0.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |