C25H28FNO2 — CID 59110450
(3R,3aS,4S,5R,6S,7aR)-5-ethyl-4-[(E)-2-[5-(2-fluorophenyl)-2-pyridinyl]ethenyl]-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 59110450) has the molecular formula C25H28FNO2 and a molecular weight of 393.50 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-5-ethyl-4-[(E)-2-[5-(2-fluorophenyl)-2-pyridinyl]ethenyl]-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-5-ethyl-4-[(E)-2-[5-(2-fluorophenyl)-2-pyridinyl]ethenyl]-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 59110450 |
| Molecular Formula | C25H28FNO2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-5-ethyl-4-[(E)-2-[5-(2-fluorophenyl)-2-pyridinyl]ethenyl]-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CC[C@H]1[C@H](/C=C/c2ccc(-c3ccccc3F)cn2)[C@@H]2[C@@H](C)OC(=O)[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C25H28FNO2/c1-4-19-15(2)13-22-24(16(3)29-25(22)28)21(19)12-11-18-10-9-17(14-27-18)20-7-5-6-8-23(20)26/h5-12,14-16,19,21-22,24H,4,13H2,1-3H3/b12-11+/t15-,16+,19+,21-,22+,24-/m0/s1 |
| InChIKey | VVQVSVPNMCINNQ-AUIGWNKOSA-N |
| XLogP | 5.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |