C20H27NO2 — CID 59110457
(3R,3aS,4S,5R,6S,7aR)-3,5,6,7a-tetramethyl-4-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 59110457) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-3,5,6,7a-tetramethyl-4-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-3,5,6,7a-tetramethyl-4-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 59110457 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-3,5,6,7a-tetramethyl-4-[(E)-2-(5-methyl-2-pyridinyl)ethenyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | Cc1ccc(/C=C/[C@H]2[C@H](C)[C@@H](C)C[C@@]3(C)C(=O)O[C@H](C)[C@@H]23)nc1 |
| InChI | InChI=1S/C20H27NO2/c1-12-6-7-16(21-11-12)8-9-17-14(3)13(2)10-20(5)18(17)15(4)23-19(20)22/h6-9,11,13-15,17-18H,10H2,1-5H3/b9-8+/t13-,14+,15+,17-,18-,20+/m0/s1 |
| InChIKey | YOPQJRGANKYMQK-YIGSFKFPSA-N |
| XLogP | 4.26 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |