About (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione
(1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 59110717) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
Molecular Properties
| Compound Name | (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| PubChem CID | 59110717 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CC(C)[C@H](O)[C@]12C(=O)O[C@H]1CC(=O)N2C |
| InChI | InChI=1S/C10H15NO4/c1-5(2)8(13)10-6(15-9(10)14)4-7(12)11(10)3/h5-6,8,13H,4H2,1-3H3/t6-,8-,10-/m0/s1 |
| InChIKey | GKTHKWIUZYEQMH-HKPALBBZSA-N |
| XLogP | -0.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
The IUPAC name of (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (CID 59110717) is (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
What is the SMILES notation for (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
The canonical SMILES for (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione is CC(C)[C@H](O)[C@]12C(=O)O[C@H]1CC(=O)N2C.
What is the InChIKey of (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
The InChIKey is GKTHKWIUZYEQMH-HKPALBBZSA-N. The full InChI is InChI=1S/C10H15NO4/c1-5(2)8(13)10-6(15-9(10)14)4-7(12)11(10)3/h5-6,8,13H,4H2,1-3H3/t6-,8-,10-/m0/s1.
What are the key properties of (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione?
(1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione has a molecular weight of 213.23 g/mol, XLogP of -0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-2-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione is sourced from PubChem (CID 59110717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).