C15H27NOSi — CID 59110807
N-[2,3,3a,7a-tetrahydro-1H-inden-2-yloxy(dimethyl)silyl]-2-methylpropan-2-amine (PubChem CID 59110807) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is N-[2,3,3a,7a-tetrahydro-1H-inden-2-yloxy(dimethyl)silyl]-2-methylpropan-2-amine.
| Compound Name | N-[2,3,3a,7a-tetrahydro-1H-inden-2-yloxy(dimethyl)silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59110807 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-[2,3,3a,7a-tetrahydro-1H-inden-2-yloxy(dimethyl)silyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N[Si](C)(C)OC1CC2C=CC=CC2C1 |
| InChI | InChI=1S/C15H27NOSi/c1-15(2,3)16-18(4,5)17-14-10-12-8-6-7-9-13(12)11-14/h6-9,12-14,16H,10-11H2,1-5H3 |
| InChIKey | MNGVSORKEXUGBF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|