C19H26P2 — CID 59110897
(4R)-2,3,4,5-tetramethyl-6-[(4S)-3,5,6-trimethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 59110897) has the molecular formula C19H26P2 and a molecular weight of 316.37 g/mol. Its IUPAC name is (4R)-2,3,4,5-tetramethyl-6-[(4S)-3,5,6-trimethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (4R)-2,3,4,5-tetramethyl-6-[(4S)-3,5,6-trimethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 59110897 |
| Molecular Formula | C19H26P2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (4R)-2,3,4,5-tetramethyl-6-[(4S)-3,5,6-trimethyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]-1-phosphabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC1=C(C)[P@@]2C[C@@H]1C(C)=C2C1=C(C)[C@]2(C)C[P@]1C(C)=C2C |
| InChI | InChI=1S/C19H26P2/c1-10-14(5)20-8-16(10)11(2)17(20)18-13(4)19(7)9-21(18)15(6)12(19)3/h16H,8-9H2,1-7H3/t16-,19+,20+,21+/m0/s1 |
| InChIKey | YHOXOAJTAJHXOO-LLUDDFSJSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|