C37H41P — CID 59110904
[(13S)-4-[(13S)-3,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-4-yl]-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl]phosphane (PubChem CID 59110904) has the molecular formula C37H41P and a molecular weight of 516.71 g/mol. Its IUPAC name is [(13S)-4-[(13S)-3,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-4-yl]-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl]phosphane.
| Compound Name | [(13S)-4-[(13S)-3,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-4-yl]-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl]phosphane |
|---|---|
| PubChem CID | 59110904 |
| Molecular Formula | C37H41P |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | [(13S)-4-[(13S)-3,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-4-yl]-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-yl]phosphane |
| SMILES | Cc1ccc2c3c(ccc2c1-c1c(P)ccc2c4c(ccc12)C1CCC[C@@]1(C)CC4)C1CCC[C@@]1(C)CC3 |
| InChI | InChI=1S/C37H41P/c1-22-8-9-23-25-16-20-36(2)18-4-6-31(36)27(25)10-12-29(23)34(22)35-30-13-11-28-26(24(30)14-15-33(35)38)17-21-37(3)19-5-7-32(28)37/h8-15,31-32H,4-7,16-21,38H2,1-3H3/t31?,32?,36-,37-/m0/s1 |
| InChIKey | XHWHAWDTDXCFLN-VFSHFCHDSA-N |
| XLogP | 9.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|