C28H36FN3O5 — CID 59111387
[4-[(1R,2R)-2-[[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]carbamoyl]cyclohexyl]phenyl]methyl N-(3-ethoxypropyl)carbamate (PubChem CID 59111387) has the molecular formula C28H36FN3O5 and a molecular weight of 513.61 g/mol. Its IUPAC name is [4-[(1R,2R)-2-[[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]carbamoyl]cyclohexyl]phenyl]methyl N-(3-ethoxypropyl)carbamate.
| Compound Name | [4-[(1R,2R)-2-[[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]carbamoyl]cyclohexyl]phenyl]methyl N-(3-ethoxypropyl)carbamate |
|---|---|
| PubChem CID | 59111387 |
| Molecular Formula | C28H36FN3O5 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | [4-[(1R,2R)-2-[[(1S)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]carbamoyl]cyclohexyl]phenyl]methyl N-(3-ethoxypropyl)carbamate |
| SMILES | CCOCCCNC(=O)OCc1ccc([C@@H]2CCCC[C@H]2C(=O)N[C@H](C(N)=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H36FN3O5/c1-2-36-17-5-16-31-28(35)37-18-19-8-10-20(11-9-19)23-6-3-4-7-24(23)27(34)32-25(26(30)33)21-12-14-22(29)15-13-21/h8-15,23-25H,2-7,16-18H2,1H3,(H2,30,33)(H,31,35)(H,32,34)/t23-,24+,25-/m0/s1 |
| InChIKey | RYRMJYQGJXLJRS-GVAUOCQISA-N |
| XLogP | 4.10 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|