About ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium
ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium (PubChem CID 59112030) has the molecular formula C12H9FO3WY-2
and a molecular weight of 492.95 g/mol. Its IUPAC name is ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium.
Molecular Properties
| Compound Name | ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium |
| PubChem CID | 59112030 |
| Molecular Formula | C12H9FO3WY-2 |
| Molecular Weight | 492.95 g/mol |
| Exact Mass | 492.91 |
| IUPAC Name | ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium |
| SMILES | [H]/[C-]=C(/C(=O)OCC)C(=O)c1c[c-]ccc1F.[W].[Y] |
| InChI | InChI=1S/C12H9FO3.W.Y/c1-3-16-12(15)8(2)11(14)9-6-4-5-7-10(9)13;;/h2,5-7H,3H2,1H3;;/q-2;; |
| InChIKey | HWMAZDGLUQMDSI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.95 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium?
The IUPAC name of ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium (CID 59112030) is ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium.
What is the SMILES notation for ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium?
The canonical SMILES for ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium is [H]/[C-]=C(/C(=O)OCC)C(=O)c1c[c-]ccc1F.[W].[Y].
What is the InChIKey of ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium?
The InChIKey is HWMAZDGLUQMDSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FO3.W.Y/c1-3-16-12(15)8(2)11(14)9-6-4-5-7-10(9)13;;/h2,5-7H,3H2,1H3;;/q-2;;.
What are the key properties of ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium?
ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium has a molecular weight of 492.95 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-fluorobenzene-5-ide-1-carbonyl)prop-2-enoate;tungsten;yttrium is sourced from PubChem (CID 59112030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).