About CID 59112187
CID 59112187 (PubChem CID 59112187) has the molecular formula C10H19N2O
and a molecular weight of 183.27 g/mol.
Molecular Properties
| Compound Name | CID 59112187 |
| PubChem CID | 59112187 |
| Molecular Formula | C10H19N2O |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | — |
| SMILES | CN=C1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C10H19N2O/c1-9(2)6-8(11-5)7-10(3,4)12(9)13/h6-7H2,1-5H3 |
| InChIKey | YOHPSZNFDPFHRQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59112187 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59112187?
The IUPAC name of CID 59112187 (CID 59112187) is not available.
What is the SMILES notation for CID 59112187?
The canonical SMILES for CID 59112187 is CN=C1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 59112187?
The InChIKey is YOHPSZNFDPFHRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N2O/c1-9(2)6-8(11-5)7-10(3,4)12(9)13/h6-7H2,1-5H3.
What are the key properties of CID 59112187?
CID 59112187 has a molecular weight of 183.27 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59112187 is sourced from PubChem (CID 59112187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).