C28H34N2O4Si — CID 59112276
N-[(3R,4S)-3-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3-methyl-5-nitrobenzamide (PubChem CID 59112276) has the molecular formula C28H34N2O4Si and a molecular weight of 490.68 g/mol. Its IUPAC name is N-[(3R,4S)-3-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3-methyl-5-nitrobenzamide.
| Compound Name | N-[(3R,4S)-3-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 59112276 |
| Molecular Formula | C28H34N2O4Si |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-[(3R,4S)-3-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3-methyl-5-nitrobenzamide |
| SMILES | CO[Si](C)(C)CCC[C@H]1CCc2ccc3ccccc3c2[C@H]1NC(=O)c1cc(C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H34N2O4Si/c1-19-16-23(18-24(17-19)30(32)33)28(31)29-27-22(9-7-15-35(3,4)34-2)14-13-21-12-11-20-8-5-6-10-25(20)26(21)27/h5-6,8,10-12,16-18,22,27H,7,9,13-15H2,1-4H3,(H,29,31)/t22-,27-/m0/s1 |
| InChIKey | PFAZETQTQNKSRS-CUNXSJBXSA-N |
| XLogP | 6.72 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|