C13H21F9OSi — CID 59112300
methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-dipropylsilane (PubChem CID 59112300) has the molecular formula C13H21F9OSi and a molecular weight of 392.38 g/mol. Its IUPAC name is methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-dipropylsilane.
| Compound Name | methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-dipropylsilane |
|---|---|
| PubChem CID | 59112300 |
| Molecular Formula | C13H21F9OSi |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | methoxy-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-dipropylsilane |
| SMILES | CCC[Si](CCC)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C13H21F9OSi/c1-4-7-24(23-3,8-5-2)9-6-10(14,15)11(16,17)12(18,19)13(20,21)22/h4-9H2,1-3H3 |
| InChIKey | ZVEHHWPNYCZVOL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|