C10H13F11OSi — CID 59112301
methoxy-dimethyl-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane (PubChem CID 59112301) has the molecular formula C10H13F11OSi and a molecular weight of 386.28 g/mol. Its IUPAC name is methoxy-dimethyl-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane.
| Compound Name | methoxy-dimethyl-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane |
|---|---|
| PubChem CID | 59112301 |
| Molecular Formula | C10H13F11OSi |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | methoxy-dimethyl-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane |
| SMILES | CO[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F11OSi/c1-22-23(2,3)5-4-6(11,12)7(13,14)8(15,16)9(17,18)10(19,20)21/h4-5H2,1-3H3 |
| InChIKey | WFZJYADZJMGVDA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|