C8H13F7OSi — CID 59112304
3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dimethylsilane (PubChem CID 59112304) has the molecular formula C8H13F7OSi and a molecular weight of 286.26 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dimethylsilane.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dimethylsilane |
|---|---|
| PubChem CID | 59112304 |
| Molecular Formula | C8H13F7OSi |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentyl-methoxy-dimethylsilane |
| SMILES | CO[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13F7OSi/c1-16-17(2,3)5-4-6(9,10)7(11,12)8(13,14)15/h4-5H2,1-3H3 |
| InChIKey | UDADITZQUBTFAY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|