About methoxy-dipropyl-(3,3,3-trifluoropropyl)silane
methoxy-dipropyl-(3,3,3-trifluoropropyl)silane (PubChem CID 59112308) has the molecular formula C10H21F3OSi
and a molecular weight of 242.36 g/mol. Its IUPAC name is methoxy-dipropyl-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | methoxy-dipropyl-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 59112308 |
| Molecular Formula | C10H21F3OSi |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methoxy-dipropyl-(3,3,3-trifluoropropyl)silane |
| SMILES | CCC[Si](CCC)(CCC(F)(F)F)OC |
| InChI | InChI=1S/C10H21F3OSi/c1-4-7-15(14-3,8-5-2)9-6-10(11,12)13/h4-9H2,1-3H3 |
| InChIKey | PHEQYVHOQDYTSV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methoxy-dipropyl-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy-dipropyl-(3,3,3-trifluoropropyl)silane?
The IUPAC name of methoxy-dipropyl-(3,3,3-trifluoropropyl)silane (CID 59112308) is methoxy-dipropyl-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for methoxy-dipropyl-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for methoxy-dipropyl-(3,3,3-trifluoropropyl)silane is CCC[Si](CCC)(CCC(F)(F)F)OC.
What is the InChIKey of methoxy-dipropyl-(3,3,3-trifluoropropyl)silane?
The InChIKey is PHEQYVHOQDYTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3OSi/c1-4-7-15(14-3,8-5-2)9-6-10(11,12)13/h4-9H2,1-3H3.
What are the key properties of methoxy-dipropyl-(3,3,3-trifluoropropyl)silane?
methoxy-dipropyl-(3,3,3-trifluoropropyl)silane has a molecular weight of 242.36 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-dipropyl-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 59112308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).