C14H15F17OSi — CID 59112314
methoxy-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane (PubChem CID 59112314) has the molecular formula C14H15F17OSi and a molecular weight of 550.33 g/mol. Its IUPAC name is methoxy-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane.
| Compound Name | methoxy-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane |
|---|---|
| PubChem CID | 59112314 |
| Molecular Formula | C14H15F17OSi |
| Molecular Weight | 550.33 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | methoxy-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane |
| SMILES | CO[Si](CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F17OSi/c1-32-33(6-3-9(17,18)19,7-4-10(20,21)22)5-2-8(15,16)11(23,24)12(25,26)13(27,28)14(29,30)31/h2-7H2,1H3 |
| InChIKey | XVIJLCJZEOPVOI-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.33 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|